CAS 2216746-84-6 is the registry number for (S)-4-(1-Amino-2,2,2-trifluoroethyl)phenol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(1S)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride (CAS 2216746-84-6) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 4-[(1S)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride. InChIKey: JDMQNFSWVGXQKQ-FJXQXJEOSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride |
| InChIKey | JDMQNFSWVGXQKQ-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)O.Cl |
Computed by PubChem (NCBI)