Products 1423034-14-3
CAS 1423034-14-3 appears in our catalog under these names: 2-Amino-2-(3,4,5-trifluorophenyl)ethan-1-ol hydrochloride, 95%, 2-Amino-2-(3,4,5-trifluorophenyl)ethan-1-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2-amino-2-(3,4,5-trifluorophenyl)ethanol;hydrochloride (CAS 1423034-14-3) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 2-amino-2-(3,4,5-trifluorophenyl)ethanol;hydrochloride. InChIKey: DNSYHLZRQMFQCY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 2-amino-2-(3,4,5-trifluorophenyl)ethanol;hydrochloride |
| InChIKey | DNSYHLZRQMFQCY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(CO)N.Cl |
Computed by PubChem (NCBI)