CAS 1185304-48-6 appears in our catalog under these names: 4-Methoxy-2-(trifluoromethyl)aniline hydrochloride, 95%, 4-Methoxy-2-(trifluoromethyl)aniline hydrochloride, 95+%, 4-Methoxy-2-(trifluoromethyl)phenylaminehydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 2,5g, 0,25g.
4-methoxy-2-(trifluoromethyl)aniline;hydrochloride (CAS 1185304-48-6) is a chemical compound with the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. IUPAC name: 4-methoxy-2-(trifluoromethyl)aniline;hydrochloride. InChIKey: AORFTHQHDDZQDO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3NO |
|---|---|
| Molecular weight | 227.61 g/mol |
| IUPAC name | 4-methoxy-2-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | AORFTHQHDDZQDO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)