CAS 106515-31-5 is the registry number for Benzo[f]pyrido[2,3-b][1,4]thiazepin-6(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5H-pyrido[2,3-b][1,4]benzothiazepin-6-one (CAS 106515-31-5) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 5H-pyrido[2,3-b][1,4]benzothiazepin-6-one. InChIKey: FTMBGAIUQQPJDQ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5H-pyrido[2,3-b][1,4]benzothiazepin-6-one |
| InChIKey | FTMBGAIUQQPJDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=C(S2)N=CC=C3 |
Computed by PubChem (NCBI)