CAS 26059-85-8 appears in our catalog under these names: 2-(Thiophen-2-yl)-3,4-dihydroquinazolin-4-one, 95%, 2-(Thiophen-2-yl)quinazolin-4(3H)-one, 98%, 2-(Thiophen-2-yl)-3,4-dihydroquinazolin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.
2-thiophen-2-yl-3H-quinazolin-4-one (CAS 26059-85-8) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 2-thiophen-2-yl-3H-quinazolin-4-one. InChIKey: SVVNZCGMBNAQFW-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 2-thiophen-2-yl-3H-quinazolin-4-one |
| InChIKey | SVVNZCGMBNAQFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)C3=CC=CS3 |
Computed by PubChem (NCBI)