CAS 35978-39-3 appears in our catalog under these names: 5-Phenylthieno(2,3-d)pyrimidin-4-ol, 5-Phenylthieno[2,3-d]pyrimidin-4(3H)-one 98%, 5-Phenylthieno[2,3-d]pyrimidin-4(3H)-one, 98%, 98%, 5-Phenyl-3H-thieno[2,3-d]pyrimidin-4-one, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg.
5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 35978-39-3) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: OLGMRBGIXZANNV-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | OLGMRBGIXZANNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)