CAS 209853-24-7 appears in our catalog under these names: 6-Phenylthieno[3,2-d]pyrimidin-4(3h)-one, 95%, 6-Phenyl-3,4-dihydrothieno[3,2-d]pyrimidin-4-one. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 50mg, 500mg, 2.5g.
6-phenyl-3H-thieno[3,2-d]pyrimidin-4-one (CAS 209853-24-7) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 6-phenyl-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: XSAILWORLBSSMS-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 6-phenyl-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | XSAILWORLBSSMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)C(=O)NC=N3 |
Computed by PubChem (NCBI)