CAS 35970-78-6 appears in our catalog under these names: 6-Phenylthieno[2,3-d]pyrimidin-4(3h)-one, 95%, 6-Phenylthieno[2,3-d]pyrimidin-4(3H)-one, 97%, 97%, 6-Phenyl-3H-thieno[2,3-d]pyrimidin-4-one, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 35970-78-6) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: DOGYRNXYBVJXFA-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | DOGYRNXYBVJXFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)N=CNC3=O |
Computed by PubChem (NCBI)