Products 4322-83-2
CAS 4322-83-2 is the registry number for 2-(Pyridin-2-yl)benzo[d]isothiazol-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyridin-2-yl-1,2-benzothiazol-3-one (CAS 4322-83-2) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 2-pyridin-2-yl-1,2-benzothiazol-3-one. InChIKey: FERJOBBPSYQFLY-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 2-pyridin-2-yl-1,2-benzothiazol-3-one |
| InChIKey | FERJOBBPSYQFLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)