CAS 2248255-29-8 is the registry number for 7-Phenyl-5H-imidazo[2,1-b][1,3]thiazin-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-phenylimidazo[2,1-b][1,3]thiazin-5-one (CAS 2248255-29-8) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 7-phenylimidazo[2,1-b][1,3]thiazin-5-one. InChIKey: MZEBQUGXQRRGHR-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 7-phenylimidazo[2,1-b][1,3]thiazin-5-one |
| InChIKey | MZEBQUGXQRRGHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)N3C=CN=C3S2 |
Computed by PubChem (NCBI)