CAS 74630-73-2 appears in our catalog under these names: 6-Phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde, 95%, 6–Phenylimidazo(2,1–b)thiazole–5–carbaldehyde. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
6-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (CAS 74630-73-2) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 6-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde. InChIKey: RRHHDLZBYCPJAW-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 6-phenylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| InChIKey | RRHHDLZBYCPJAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C=CSC3=N2)C=O |
Computed by PubChem (NCBI)