CAS 52024-70-1 is the registry number for 6-Phenoxy-3-pyridinyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-isothiocyanato-2-phenoxypyridine (CAS 52024-70-1) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 5-isothiocyanato-2-phenoxypyridine. InChIKey: YGSFMZIJHMEICM-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5-isothiocyanato-2-phenoxypyridine |
| InChIKey | YGSFMZIJHMEICM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)