CAS 116082-89-4 appears in our catalog under these names: 5-(Naphthalen-1-yl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(Naphthalen-1-yl)-1,3,4-oxadiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-naphthalen-1-yl-3H-1,3,4-oxadiazole-2-thione (CAS 116082-89-4) is a chemical compound with the molecular formula C12H8N2OS and a molecular weight of 228.27 g/mol. IUPAC name: 5-naphthalen-1-yl-3H-1,3,4-oxadiazole-2-thione. InChIKey: QPQZHFCLUMQFBO-UHFFFAOYSA-N.
| Molecular formula | C12H8N2OS |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 5-naphthalen-1-yl-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | QPQZHFCLUMQFBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NNC(=S)O3 |
Computed by PubChem (NCBI)