CAS 1092390-14-1 is the registry number for 2-Amino-1-(4-trifluoromethoxyphenyl)ethanone Hydrochloride. Offered by: TRC. Available pack sizes: 5g.
2-amino-1-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride (CAS 1092390-14-1) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 2-amino-1-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride. InChIKey: NZMDFORULDJBNT-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 2-amino-1-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride |
| InChIKey | NZMDFORULDJBNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CN)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)