CAS 163119-28-6 appears in our catalog under these names: Lansoprazole Impurity 1, Lansoprazole Impurity 19, 2-Chloromethyl-3-methyl-4-(2,2,2-trifluoroethoxy)pyridine N-Oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
2-(chloromethyl)-3-methyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium (CAS 163119-28-6) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 2-(chloromethyl)-3-methyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium. InChIKey: RHMLJJHQPXWHRI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 2-(chloromethyl)-3-methyl-1-oxido-4-(2,2,2-trifluoroethoxy)pyridin-1-ium |
| InChIKey | RHMLJJHQPXWHRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1CCl)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)