Products 2287272-38-0

CAS 2287272-38-0 is the registry number for Methyl 2-amino-5-(trifluoromethyl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-5-(trifluoromethyl)benzoate;hydrochloride (CAS 2287272-38-0) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: methyl 2-amino-5-(trifluoromethyl)benzoate;hydrochloride. InChIKey: XOUMGUYLDOXWOE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClF3NO2
Molecular weight255.62 g/mol
IUPAC namemethyl 2-amino-5-(trifluoromethyl)benzoate;hydrochloride
InChIKeyXOUMGUYLDOXWOE-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)C(F)(F)F)N.Cl

Computed by PubChem (NCBI)