Products 144789-74-2
CAS 144789-74-2 is the registry number for (R)-2-Amino-2-(4-(trifluoromethyl)phenyl)acetic acid hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid;hydrochloride (CAS 144789-74-2) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: (2R)-2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid;hydrochloride. InChIKey: WICWPISQRZFEEC-OGFXRTJISA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | (2R)-2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid;hydrochloride |
| InChIKey | WICWPISQRZFEEC-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)