CAS 870483-31-1 appears in our catalog under these names: 2-Amino-3-(3,4,5-trifluorophenyl)propanoic acid hydrochloride, 95%, 2–Amino–3–(3,4,5–trifluorophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g.
2-amino-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride (CAS 870483-31-1) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 2-amino-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride. InChIKey: QCVCLPJIZUMSBO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 2-amino-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride |
| InChIKey | QCVCLPJIZUMSBO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)