CAS 2231023-63-3 appears in our catalog under these names: 2-Amino-2-(4-(trifluoromethyl)phenyl)acetic acid hydrochloride, 95%, (S)-2-Amino-2-(4-(trifluoromethyl)phenyl)acetic acid hydrochloride, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, 10g, on request.
2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid;hydrochloride (CAS 2231023-63-3) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid;hydrochloride. InChIKey: WICWPISQRZFEEC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 2-amino-2-[4-(trifluoromethyl)phenyl]acetic acid;hydrochloride |
| InChIKey | WICWPISQRZFEEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)