Products 2098497-31-3
CAS 2098497-31-3 is the registry number for 3,4,5-Trifluoro-d-phenylalanine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R)-2-amino-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride (CAS 2098497-31-3) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: (2R)-2-amino-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride. InChIKey: QCVCLPJIZUMSBO-OGFXRTJISA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,4,5-trifluorophenyl)propanoic acid;hydrochloride |
| InChIKey | QCVCLPJIZUMSBO-OGFXRTJISA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)