CAS 1965309-68-5 appears in our catalog under these names: 4-(1-Amino-2,2,2-trifluoro-ethyl)-benzoic acid hydrochloride, 96%, 4-(1-Amino-2,2,2-trifluoroethyl)benzoic acid hydrochloride, Benzoic acid, 4-(1-amino-2,2,2-trifluoroethyl)-, hydrochloride (1:1), 96%, 96%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg, 500mg.
4-(1-amino-2,2,2-trifluoroethyl)benzoic acid;hydrochloride (CAS 1965309-68-5) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 4-(1-amino-2,2,2-trifluoroethyl)benzoic acid;hydrochloride. InChIKey: ORNIOUZAQHFFKY-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 4-(1-amino-2,2,2-trifluoroethyl)benzoic acid;hydrochloride |
| InChIKey | ORNIOUZAQHFFKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)C(=O)O.Cl |
Computed by PubChem (NCBI)