CAS 1391384-65-8 appears in our catalog under these names: (S)-3-(1-Amino-2,2,2-trifluoroethyl)benzoic acid hydrochloride, 95%, (S)-3-(1-Amino-2,2,2-trifluoroethyl)benzoic acid hydrochloride, 97%, (S)–3–(1–Amino–2,2,2–trifluoroethyl)benzoic acid hydrochloride, (S)-3-(1-Amino-2,2,2-trifluoroethyl)benzoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoic acid;hydrochloride (CAS 1391384-65-8) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoic acid;hydrochloride. InChIKey: PGVLYBVVIMPTQZ-FJXQXJEOSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 3-[(1S)-1-amino-2,2,2-trifluoroethyl]benzoic acid;hydrochloride |
| InChIKey | PGVLYBVVIMPTQZ-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)