CAS 1134915-25-5 appears in our catalog under these names: 2-(3-Trifluoromethylphenyl)glycine HCl, 95%, 2–(3–Trifluoromethylphenyl)glycine hydrochloride, 2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hydrochloride, 2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hydrochloride, >97%, >97%, 2-(3-Trifluoromethylphenyl)glycine (hydrochloride). Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 10g, Get quote.
2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid;hydrochloride (CAS 1134915-25-5) is a chemical compound with the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. IUPAC name: 2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid;hydrochloride. InChIKey: SECHOAVQAILTSH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3NO2 |
|---|---|
| Molecular weight | 255.62 g/mol |
| IUPAC name | 2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid;hydrochloride |
| InChIKey | SECHOAVQAILTSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)