Products 1118787-91-9

CAS 1118787-91-9 is the registry number for Methyl 2-chloro-5-(chlorosulfonyl)pyridine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-5-chlorosulfonylpyridine-3-carboxylate (CAS 1118787-91-9) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: methyl 2-chloro-5-chlorosulfonylpyridine-3-carboxylate. InChIKey: HPPMSUMZDZOGEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2NO4S
Molecular weight270.09 g/mol
IUPAC namemethyl 2-chloro-5-chlorosulfonylpyridine-3-carboxylate
InChIKeyHPPMSUMZDZOGEZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(N=CC(=C1)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)