Products 1784963-98-9
CAS 1784963-98-9 is the registry number for 6,6-Difluoro-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,6-difluoro-4,5-dihydro-1H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 1784963-98-9) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 6,6-difluoro-4,5-dihydro-1H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: XUWLDHFVZIJNGX-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 6,6-difluoro-4,5-dihydro-1H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | XUWLDHFVZIJNGX-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C(=NN2)C(=O)O)(F)F |
Computed by PubChem (NCBI)