CAS 1261617-68-8 is the registry number for 2-(Difluoromethyl)-4-nitroaniline, 95+%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
2-(difluoromethyl)-4-nitroaniline (CAS 1261617-68-8) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(difluoromethyl)-4-nitroaniline. InChIKey: RYZAPERFOMDBFO-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(difluoromethyl)-4-nitroaniline |
| InChIKey | RYZAPERFOMDBFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)F)N |
Computed by PubChem (NCBI)