CAS 2247106-89-2 is the registry number for 5,5-Difluoro-5,6-dihydro-4H-pyrrolo(1,2-b)pyrazole-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5,5-difluoro-4,6-dihydropyrrolo[2,1-e]pyrazole-2-carboxylic acid (CAS 2247106-89-2) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 5,5-difluoro-4,6-dihydropyrrolo[2,1-e]pyrazole-2-carboxylic acid. InChIKey: UBTWQGPWURKTRC-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 5,5-difluoro-4,6-dihydropyrrolo[2,1-e]pyrazole-2-carboxylic acid |
| InChIKey | UBTWQGPWURKTRC-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=NN2CC1(F)F)C(=O)O |
Computed by PubChem (NCBI)