CAS 1261605-86-0 is the registry number for 2-(Difluoromethyl)-5-nitroaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethyl)-5-nitroaniline (CAS 1261605-86-0) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 2-(difluoromethyl)-5-nitroaniline. InChIKey: GSMDEYXYXOMUKZ-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2-(difluoromethyl)-5-nitroaniline |
| InChIKey | GSMDEYXYXOMUKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)C(F)F |
Computed by PubChem (NCBI)