CAS 161886-20-0 appears in our catalog under these names: (2,2-Difluorobenzo(d)(1,3)dioxol-5-yl)hydrazine, 97%, (2,2-Difluoro-1,3-dioxaindan-5-yl)hydrazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,2-difluoro-1,3-benzodioxol-5-yl)hydrazine (CAS 161886-20-0) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)hydrazine. InChIKey: WXMDAOOESUBUNV-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)hydrazine |
| InChIKey | WXMDAOOESUBUNV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NN)OC(O2)(F)F |
Computed by PubChem (NCBI)