CAS 1744-12-3 is the registry number for 2,2-Difluorobenzo(d)(1,3)dioxole-5,6-diamine, 98+%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g.
2,2-difluoro-1,3-benzodioxole-5,6-diamine (CAS 1744-12-3) is a chemical compound with the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxole-5,6-diamine. InChIKey: CIEFLILRAGWNHE-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O2 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxole-5,6-diamine |
| InChIKey | CIEFLILRAGWNHE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)N)N |
Computed by PubChem (NCBI)