Products 1131615-04-7
CAS 1131615-04-7 appears in our catalog under these names: 3–Bromo–4–(difluoromethyl)benzoic acid, 3-Bromo-4-(difluoromethyl)benzoic acid, 95%, 95%, 3-Bromo-4-(difluoromethyl)benzoic acid, 96%, 3-Bromo-4-(difluoromethyl)benzoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
3-bromo-4-(difluoromethyl)benzoic acid (CAS 1131615-04-7) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 3-bromo-4-(difluoromethyl)benzoic acid. InChIKey: QUYNTKMTYJLIIG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 3-bromo-4-(difluoromethyl)benzoic acid |
| InChIKey | QUYNTKMTYJLIIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Br)C(F)F |
Computed by PubChem (NCBI)