CAS 1136-49-8 is the registry number for 4,8-Dichloro-3-ethyl-2-methylquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,8-dichloro-3-ethyl-2-methylquinoline (CAS 1136-49-8) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 4,8-dichloro-3-ethyl-2-methylquinoline. InChIKey: DWMPQXINJJRHOZ-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 4,8-dichloro-3-ethyl-2-methylquinoline |
| InChIKey | DWMPQXINJJRHOZ-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C2C(=C1Cl)C=CC=C2Cl)C |
Computed by PubChem (NCBI)