CAS 213755-91-0 is the registry number for 1-(3,4-Dichlorophenyl)cyclopentanecarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3,4-dichlorophenyl)cyclopentane-1-carbonitrile (CAS 213755-91-0) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)cyclopentane-1-carbonitrile. InChIKey: LIPSDVBHSHEGGB-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)cyclopentane-1-carbonitrile |
| InChIKey | LIPSDVBHSHEGGB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)