CAS 935772-63-7 is the registry number for 9-(Dichloromethylene)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-5-amine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
11-(dichloromethylidene)tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine (CAS 935772-63-7) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 11-(dichloromethylidene)tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine. InChIKey: VLBAAZYGJAXMBQ-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 11-(dichloromethylidene)tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-3-amine |
| InChIKey | VLBAAZYGJAXMBQ-UHFFFAOYSA-N |
| SMILES | C1CC2C(=C(Cl)Cl)C1C3=C2C(=CC=C3)N |
Computed by PubChem (NCBI)