CAS 794582-35-7 appears in our catalog under these names: 2-Chloro-3-(chloromethyl)-7,8-dimethylquinoline, 95%, 2–chloro–3–(chloromethyl)–7,8–dimethylquinoline, 2-chloro-3-(chloromethyl)-7,8-dimethylquinoline, ≥96%, ≥96%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 50mg.
2-chloro-3-(chloromethyl)-7,8-dimethylquinoline (CAS 794582-35-7) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 2-chloro-3-(chloromethyl)-7,8-dimethylquinoline. InChIKey: WGNBVVFJVKLVHH-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 2-chloro-3-(chloromethyl)-7,8-dimethylquinoline |
| InChIKey | WGNBVVFJVKLVHH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=C(C=C2C=C1)CCl)Cl)C |
Computed by PubChem (NCBI)