CAS 866152-52-5 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(3,4-Dichlorophenyl)-2,5-dimethyl-1H-pyrrole, 90%, 1-(3,4-Dichlorophenyl)-2,5-dimethyl-1H-pyrrole, ≥95%, ≥95%, 1-(3,4-Dichlorophenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-(3,4-dichlorophenyl)-2,5-dimethylpyrrole (CAS 866152-52-5) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2,5-dimethylpyrrole. InChIKey: NCDPUUHTNZPKBK-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2,5-dimethylpyrrole |
| InChIKey | NCDPUUHTNZPKBK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)