CAS 406204-68-0 appears in our catalog under these names: 2,4-dichloro-8-isopropylquinoline, 98%, 2，4–Dichloro–8–propan–2–ylquinoline. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 250mg.
2,4-dichloro-8-propan-2-ylquinoline (CAS 406204-68-0) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 2,4-dichloro-8-propan-2-ylquinoline. InChIKey: LPVVAVRNSIOGAM-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 2,4-dichloro-8-propan-2-ylquinoline |
| InChIKey | LPVVAVRNSIOGAM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC2=C1N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)