CAS 1616924-00-5 appears in our catalog under these names: 1-(2,5-Dichlorophenyl)cyclopentane-1-carbonitrile, 95%, 1-(2,5-Dichlorophenyl)cyclopentane-1-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(2,5-dichlorophenyl)cyclopentane-1-carbonitrile (CAS 1616924-00-5) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)cyclopentane-1-carbonitrile. InChIKey: ZEPPSIVTTCKELV-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)cyclopentane-1-carbonitrile |
| InChIKey | ZEPPSIVTTCKELV-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C#N)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)