CAS 175205-50-2 is the registry number for 1-(3,5-Dichlorophenyl)-2,5-dimethyl-1h-pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole (CAS 175205-50-2) is a chemical compound with the molecular formula C12H11Cl2N and a molecular weight of 240.12 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole. InChIKey: PZQGRGDARNXLSP-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole |
| InChIKey | PZQGRGDARNXLSP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC(=C2)Cl)Cl)C |
Computed by PubChem (NCBI)