Products 1155544-42-5

CAS 1155544-42-5 appears in our catalog under these names: 2,2-Dimethylmorpholine-4-sulfonyl chloride, 95%, 2,2-Dimethylmorpholine-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.

2,2-dimethylmorpholine-4-sulfonyl chloride (CAS 1155544-42-5) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 2,2-dimethylmorpholine-4-sulfonyl chloride. InChIKey: ABJVXCWLNPDPCO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3S
Molecular weight213.68 g/mol
IUPAC name2,2-dimethylmorpholine-4-sulfonyl chloride
InChIKeyABJVXCWLNPDPCO-UHFFFAOYSA-N
SMILESCC1(CN(CCO1)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)