Products 2219374-13-5
CAS 2219374-13-5 is the registry number for rac-(4aR,7aS)-Hexahydro-2H-6λ6-thieno(3,4-b)(1,4)oxazine-6,6-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide;hydrochloride (CAS 2219374-13-5) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: (4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide;hydrochloride. InChIKey: GSLNNHYGXQFTMN-RIHPBJNCSA-N.
| Molecular formula | C6H12ClNO3S |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | (4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-thieno[3,4-b][1,4]oxazine 6,6-dioxide;hydrochloride |
| InChIKey | GSLNNHYGXQFTMN-RIHPBJNCSA-N |
| SMILES | C1CO[C@@H]2CS(=O)(=O)C[C@@H]2N1.Cl |
Computed by PubChem (NCBI)