Products 91673-63-1

CAS 91673-63-1 is the registry number for 5-Methyl-1-oxo-1λ4-thiomorpholine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methyl-1-oxo-1,4-thiazinane-3-carboxylic acid;hydrochloride (CAS 91673-63-1) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 5-methyl-1-oxo-1,4-thiazinane-3-carboxylic acid;hydrochloride. InChIKey: GTNAIFGSWCJGOF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3S
Molecular weight213.68 g/mol
IUPAC name5-methyl-1-oxo-1,4-thiazinane-3-carboxylic acid;hydrochloride
InChIKeyGTNAIFGSWCJGOF-UHFFFAOYSA-N
SMILESCC1CS(=O)CC(N1)C(=O)O.Cl

Computed by PubChem (NCBI)