Products 919026-20-3

CAS 919026-20-3 appears in our catalog under these names: 2,6-Dimethylmorpholine-4-sulfonyl chloride, 95%, 2,6-Dimethylmorpholine-4-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

2,6-dimethylmorpholine-4-sulfonyl chloride (CAS 919026-20-3) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 2,6-dimethylmorpholine-4-sulfonyl chloride. InChIKey: IOHUKINMPIUAFU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3S
Molecular weight213.68 g/mol
IUPAC name2,6-dimethylmorpholine-4-sulfonyl chloride
InChIKeyIOHUKINMPIUAFU-UHFFFAOYSA-N
SMILESCC1CN(CC(O1)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)