Products 1155583-96-2

CAS 1155583-96-2 appears in our catalog under these names: Methyl(tetrahydro-2H-pyran-4-yl)sulfamoyl chloride, 98%, N-Methyl-N-(oxan-4-yl)sulfamoyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

N-methyl-N-(oxan-4-yl)sulfamoyl chloride (CAS 1155583-96-2) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: N-methyl-N-(oxan-4-yl)sulfamoyl chloride. InChIKey: ZWWBGYONISXJSE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3S
Molecular weight213.68 g/mol
IUPAC nameN-methyl-N-(oxan-4-yl)sulfamoyl chloride
InChIKeyZWWBGYONISXJSE-UHFFFAOYSA-N
SMILESCN(C1CCOCC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)