Products 2416231-20-2

CAS 2416231-20-2 is the registry number for 2-(1-Oxidothiomorpholino)acetic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(1-oxo-1,4-thiazinan-4-yl)acetic acid;hydrochloride (CAS 2416231-20-2) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 2-(1-oxo-1,4-thiazinan-4-yl)acetic acid;hydrochloride. InChIKey: YXVOVOQLVIYOQF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3S
Molecular weight213.68 g/mol
IUPAC name2-(1-oxo-1,4-thiazinan-4-yl)acetic acid;hydrochloride
InChIKeyYXVOVOQLVIYOQF-UHFFFAOYSA-N
SMILESC1CS(=O)CCN1CC(=O)O.Cl

Computed by PubChem (NCBI)