CAS 2378499-11-5 is the registry number for rac-(1R,3R)-3-(Imino(methyl)oxo-λ6-sulfanyl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(methylsulfonimidoyl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2378499-11-5) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 3-(methylsulfonimidoyl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: AJBSAUYUBAOOBO-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO3S |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 3-(methylsulfonimidoyl)cyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | AJBSAUYUBAOOBO-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1CC(C1)C(=O)O.Cl |
Computed by PubChem (NCBI)