Products 1421366-09-7
CAS 1421366-09-7 is the registry number for (2R,6S)-2,6-Dimethylmorpholine-4-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride (CAS 1421366-09-7) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride. InChIKey: IOHUKINMPIUAFU-OLQVQODUSA-N.
| Molecular formula | C6H12ClNO3S |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethylmorpholine-4-sulfonyl chloride |
| InChIKey | IOHUKINMPIUAFU-OLQVQODUSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)