Products 1308384-40-8

CAS 1308384-40-8 appears in our catalog under these names: 2-(Methoxymethyl)-1-pyrrolidinesulfonyl chloride, 95%, 2-(Methoxymethyl)pyrrolidine-1-sulfonyl chloride 95%, 2-(Methoxymethyl)pyrrolidine-1-sulfonyl chloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(methoxymethyl)pyrrolidine-1-sulfonyl chloride (CAS 1308384-40-8) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 2-(methoxymethyl)pyrrolidine-1-sulfonyl chloride. InChIKey: ZLZQXGXZMQYGDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO3S
Molecular weight213.68 g/mol
IUPAC name2-(methoxymethyl)pyrrolidine-1-sulfonyl chloride
InChIKeyZLZQXGXZMQYGDJ-UHFFFAOYSA-N
SMILESCOCC1CCCN1S(=O)(=O)Cl

Computed by PubChem (NCBI)