CAS 1216297-22-1 appears in our catalog under these names: 2,5-Dimethylmorpholine-4-sulfonyl chloride, 95%, 2,5-Dimethylmorpholine-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 50mg, 0,5g.
2,5-dimethylmorpholine-4-sulfonyl chloride (CAS 1216297-22-1) is a chemical compound with the molecular formula C6H12ClNO3S and a molecular weight of 213.68 g/mol. IUPAC name: 2,5-dimethylmorpholine-4-sulfonyl chloride. InChIKey: FGFHSVAFDFWLMD-UHFFFAOYSA-N.
| Molecular formula | C6H12ClNO3S |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | 2,5-dimethylmorpholine-4-sulfonyl chloride |
| InChIKey | FGFHSVAFDFWLMD-UHFFFAOYSA-N |
| SMILES | CC1CN(C(CO1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)