CAS 1160573-19-2 appears in our catalog under these names: 4-Chloro-3,5-difluorobenzoic Acid, 4-Chloro-3,5-difluorobenzoic acid 97%, 4-Chloro-3,5-difluorobenzoic acid, 97%, 97%, 4-Chloro-3,5-difluorobenzoic acid, 97%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 10000mg, 1g, 5g, 25g, 100g, 50g, 10g.
4-chloro-3,5-difluorobenzoic acid (CAS 1160573-19-2) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 4-chloro-3,5-difluorobenzoic acid. InChIKey: PVIHLHXXVCVGTP-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 4-chloro-3,5-difluorobenzoic acid |
| InChIKey | PVIHLHXXVCVGTP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)C(=O)O |
Computed by PubChem (NCBI)